C19H20N4O2 — CID 168875854
2-(3-cyanoanilino)-N-[(2-hydroxy-3-methylphenyl)methylideneamino]butanamide (PubChem CID 168875854) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-(3-cyanoanilino)-N-[(2-hydroxy-3-methylphenyl)methylideneamino]butanamide.
| Compound Name | 2-(3-cyanoanilino)-N-[(2-hydroxy-3-methylphenyl)methylideneamino]butanamide |
|---|---|
| PubChem CID | 168875854 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-(3-cyanoanilino)-N-[(2-hydroxy-3-methylphenyl)methylideneamino]butanamide |
| SMILES | CCC(Nc1cccc(C#N)c1)C(=O)NN=Cc1cccc(C)c1O |
| InChI | InChI=1S/C19H20N4O2/c1-3-17(22-16-9-5-7-14(10-16)11-20)19(25)23-21-12-15-8-4-6-13(2)18(15)24/h4-10,12,17,22,24H,3H2,1-2H3,(H,23,25) |
| InChIKey | KAGXXMMETRZUKE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|