C17H18FN3O3 — CID 168875871
N-[(2,3-dihydroxyphenyl)methylideneamino]-2-(3-fluoroanilino)butanamide (PubChem CID 168875871) has the molecular formula C17H18FN3O3 and a molecular weight of 331.35 g/mol. Its IUPAC name is N-[(2,3-dihydroxyphenyl)methylideneamino]-2-(3-fluoroanilino)butanamide.
| Compound Name | N-[(2,3-dihydroxyphenyl)methylideneamino]-2-(3-fluoroanilino)butanamide |
|---|---|
| PubChem CID | 168875871 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N-[(2,3-dihydroxyphenyl)methylideneamino]-2-(3-fluoroanilino)butanamide |
| SMILES | CCC(Nc1cccc(F)c1)C(=O)NN=Cc1cccc(O)c1O |
| InChI | InChI=1S/C17H18FN3O3/c1-2-14(20-13-7-4-6-12(18)9-13)17(24)21-19-10-11-5-3-8-15(22)16(11)23/h3-10,14,20,22-23H,2H2,1H3,(H,21,24) |
| InChIKey | TWSAMTWIAACDTI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|