C17H12F3N3O4S — CID 168877216
[7-cyano-1-[(4-methoxyphenyl)methyl]indazol-6-yl] trifluoromethanesulfonate (PubChem CID 168877216) has the molecular formula C17H12F3N3O4S and a molecular weight of 411.36 g/mol. Its IUPAC name is [7-cyano-1-[(4-methoxyphenyl)methyl]indazol-6-yl] trifluoromethanesulfonate.
| Compound Name | [7-cyano-1-[(4-methoxyphenyl)methyl]indazol-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 168877216 |
| Molecular Formula | C17H12F3N3O4S |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | [7-cyano-1-[(4-methoxyphenyl)methyl]indazol-6-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(Cn2ncc3ccc(OS(=O)(=O)C(F)(F)F)c(C#N)c32)cc1 |
| InChI | InChI=1S/C17H12F3N3O4S/c1-26-13-5-2-11(3-6-13)10-23-16-12(9-22-23)4-7-15(14(16)8-21)27-28(24,25)17(18,19)20/h2-7,9H,10H2,1H3 |
| InChIKey | ZNNVRJXJMTWWFT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 94.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|