C5H4ClN5S — CID 168877940
5-chloro-4-(1,2,4-triazol-1-yl)-1,3-thiazol-2-amine (PubChem CID 168877940) has the molecular formula C5H4ClN5S and a molecular weight of 201.64 g/mol. Its IUPAC name is 5-chloro-4-(1,2,4-triazol-1-yl)-1,3-thiazol-2-amine.
| Compound Name | 5-chloro-4-(1,2,4-triazol-1-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168877940 |
| Molecular Formula | C5H4ClN5S |
| Molecular Weight | 201.64 g/mol |
| Exact Mass | 200.99 |
| IUPAC Name | 5-chloro-4-(1,2,4-triazol-1-yl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-n2cncn2)c(Cl)s1 |
| InChI | InChI=1S/C5H4ClN5S/c6-3-4(10-5(7)12-3)11-2-8-1-9-11/h1-2H,(H2,7,10) |
| InChIKey | NPEJCJBVHHALBH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.64 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |