C19H26N4O3S2 — CID 168878475
N-[5-[6-(1-methylsulfonylpiperidin-4-yl)pyrazin-2-yl]thiophen-3-yl]pentanamide (PubChem CID 168878475) has the molecular formula C19H26N4O3S2 and a molecular weight of 422.58 g/mol. Its IUPAC name is N-[5-[6-(1-methylsulfonylpiperidin-4-yl)pyrazin-2-yl]thiophen-3-yl]pentanamide.
| Compound Name | N-[5-[6-(1-methylsulfonylpiperidin-4-yl)pyrazin-2-yl]thiophen-3-yl]pentanamide |
|---|---|
| PubChem CID | 168878475 |
| Molecular Formula | C19H26N4O3S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-[5-[6-(1-methylsulfonylpiperidin-4-yl)pyrazin-2-yl]thiophen-3-yl]pentanamide |
| SMILES | CCCCC(=O)Nc1csc(-c2cncc(C3CCN(S(C)(=O)=O)CC3)n2)c1 |
| InChI | InChI=1S/C19H26N4O3S2/c1-3-4-5-19(24)21-15-10-18(27-13-15)17-12-20-11-16(22-17)14-6-8-23(9-7-14)28(2,25)26/h10-14H,3-9H2,1-2H3,(H,21,24) |
| InChIKey | GDBTUJFSZNEVIJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |