About 4-[[5-(1,3-dihydroisoindol-2-ylmethyl)quinolin-8-yl]oxymethyl]-N,N-dimethylbenzamide
4-[[5-(1,3-dihydroisoindol-2-ylmethyl)quinolin-8-yl]oxymethyl]-N,N-dimethylbenzamide (PubChem CID 168879290) has the molecular formula C28H27N3O2
and a molecular weight of 437.54 g/mol. Its IUPAC name is 4-[[5-(1,3-dihydroisoindol-2-ylmethyl)quinolin-8-yl]oxymethyl]-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 4-[[5-(1,3-dihydroisoindol-2-ylmethyl)quinolin-8-yl]oxymethyl]-N,N-dimethylbenzamide |
| PubChem CID | 168879290 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 4-[[5-(1,3-dihydroisoindol-2-ylmethyl)quinolin-8-yl]oxymethyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(COc2ccc(CN3Cc4ccccc4C3)c3cccnc23)cc1 |
| InChI | InChI=1S/C28H27N3O2/c1-30(2)28(32)21-11-9-20(10-12-21)19-33-26-14-13-24(25-8-5-15-29-27(25)26)18-31-16-22-6-3-4-7-23(22)17-31/h3-15H,16-19H2,1-2H3 |
| InChIKey | KZJIEKBBFVNEQW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[5-(1,3-dihydroisoindol-2-ylmethyl)quinolin-8-yl]oxymethyl]-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-(1,3-dihydroisoindol-2-ylmethyl)quinolin-8-yl]oxymethyl]-N,N-dimethylbenzamide?
The IUPAC name of 4-[[5-(1,3-dihydroisoindol-2-ylmethyl)quinolin-8-yl]oxymethyl]-N,N-dimethylbenzamide (CID 168879290) is 4-[[5-(1,3-dihydroisoindol-2-ylmethyl)quinolin-8-yl]oxymethyl]-N,N-dimethylbenzamide.
What is the SMILES notation for 4-[[5-(1,3-dihydroisoindol-2-ylmethyl)quinolin-8-yl]oxymethyl]-N,N-dimethylbenzamide?
The canonical SMILES for 4-[[5-(1,3-dihydroisoindol-2-ylmethyl)quinolin-8-yl]oxymethyl]-N,N-dimethylbenzamide is CN(C)C(=O)c1ccc(COc2ccc(CN3Cc4ccccc4C3)c3cccnc23)cc1.
What is the InChIKey of 4-[[5-(1,3-dihydroisoindol-2-ylmethyl)quinolin-8-yl]oxymethyl]-N,N-dimethylbenzamide?
The InChIKey is KZJIEKBBFVNEQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27N3O2/c1-30(2)28(32)21-11-9-20(10-12-21)19-33-26-14-13-24(25-8-5-15-29-27(25)26)18-31-16-22-6-3-4-7-23(22)17-31/h3-15H,16-19H2,1-2H3.
What are the key properties of 4-[[5-(1,3-dihydroisoindol-2-ylmethyl)quinolin-8-yl]oxymethyl]-N,N-dimethylbenzamide?
4-[[5-(1,3-dihydroisoindol-2-ylmethyl)quinolin-8-yl]oxymethyl]-N,N-dimethylbenzamide has a molecular weight of 437.54 g/mol, XLogP of 5.03, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-(1,3-dihydroisoindol-2-ylmethyl)quinolin-8-yl]oxymethyl]-N,N-dimethylbenzamide is sourced from PubChem (CID 168879290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).