C21H25N3O2 — CID 46843060
[5-[(4-prop-2-ynylpiperidin-1-yl)methyl]quinolin-8-yl] N,N-dimethylcarbamate (PubChem CID 46843060) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is [5-[(4-prop-2-ynylpiperidin-1-yl)methyl]quinolin-8-yl] N,N-dimethylcarbamate.
| Compound Name | [5-[(4-prop-2-ynylpiperidin-1-yl)methyl]quinolin-8-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 46843060 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | [5-[(4-prop-2-ynylpiperidin-1-yl)methyl]quinolin-8-yl] N,N-dimethylcarbamate |
| SMILES | C#CCC1CCN(Cc2ccc(OC(=O)N(C)C)c3ncccc23)CC1 |
| InChI | InChI=1S/C21H25N3O2/c1-4-6-16-10-13-24(14-11-16)15-17-8-9-19(26-21(25)23(2)3)20-18(17)7-5-12-22-20/h1,5,7-9,12,16H,6,10-11,13-15H2,2-3H3 |
| InChIKey | MWFWKUPHMMXSCQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|