C28H27N5O4 — CID 46862050
[5-[[[8-(dimethylcarbamoyloxy)quinolin-5-yl]methyl-ethynylamino]methyl]quinolin-8-yl] N,N-dimethylcarbamate (PubChem CID 46862050) has the molecular formula C28H27N5O4 and a molecular weight of 497.56 g/mol. Its IUPAC name is [5-[[[8-(dimethylcarbamoyloxy)quinolin-5-yl]methyl-ethynylamino]methyl]quinolin-8-yl] N,N-dimethylcarbamate.
| Compound Name | [5-[[[8-(dimethylcarbamoyloxy)quinolin-5-yl]methyl-ethynylamino]methyl]quinolin-8-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 46862050 |
| Molecular Formula | C28H27N5O4 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | [5-[[[8-(dimethylcarbamoyloxy)quinolin-5-yl]methyl-ethynylamino]methyl]quinolin-8-yl] N,N-dimethylcarbamate |
| SMILES | C#CN(Cc1ccc(OC(=O)N(C)C)c2ncccc12)Cc1ccc(OC(=O)N(C)C)c2ncccc12 |
| InChI | InChI=1S/C28H27N5O4/c1-6-33(17-19-11-13-23(36-27(34)31(2)3)25-21(19)9-7-15-29-25)18-20-12-14-24(37-28(35)32(4)5)26-22(20)10-8-16-30-26/h1,7-16H,17-18H2,2-5H3 |
| InChIKey | UHTWTWBCIJNKOA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 88.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|