About [5-[[methyl(prop-2-ynyl)amino]methyl]quinolin-8-yl] N-(3,5-dimethyl-1-adamantyl)carbamate
[5-[[methyl(prop-2-ynyl)amino]methyl]quinolin-8-yl] N-(3,5-dimethyl-1-adamantyl)carbamate (PubChem CID 46861941) has the molecular formula C27H33N3O2
and a molecular weight of 431.58 g/mol. Its IUPAC name is [5-[[methyl(prop-2-ynyl)amino]methyl]quinolin-8-yl] N-(3,5-dimethyl-1-adamantyl)carbamate.
Molecular Properties
| Compound Name | [5-[[methyl(prop-2-ynyl)amino]methyl]quinolin-8-yl] N-(3,5-dimethyl-1-adamantyl)carbamate |
| PubChem CID | 46861941 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | [5-[[methyl(prop-2-ynyl)amino]methyl]quinolin-8-yl] N-(3,5-dimethyl-1-adamantyl)carbamate |
| SMILES | C#CCN(C)Cc1ccc(OC(=O)NC23CC4CC(C)(CC(C)(C4)C2)C3)c2ncccc12 |
| InChI | InChI=1S/C27H33N3O2/c1-5-11-30(4)15-20-8-9-22(23-21(20)7-6-10-28-23)32-24(31)29-27-14-19-12-25(2,17-27)16-26(3,13-19)18-27/h1,6-10,19H,11-18H2,2-4H3,(H,29,31) |
| InChIKey | DNQHATJXXBVTPK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-[[methyl(prop-2-ynyl)amino]methyl]quinolin-8-yl] N-(3,5-dimethyl-1-adamantyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[[methyl(prop-2-ynyl)amino]methyl]quinolin-8-yl] N-(3,5-dimethyl-1-adamantyl)carbamate?
The IUPAC name of [5-[[methyl(prop-2-ynyl)amino]methyl]quinolin-8-yl] N-(3,5-dimethyl-1-adamantyl)carbamate (CID 46861941) is [5-[[methyl(prop-2-ynyl)amino]methyl]quinolin-8-yl] N-(3,5-dimethyl-1-adamantyl)carbamate.
What is the SMILES notation for [5-[[methyl(prop-2-ynyl)amino]methyl]quinolin-8-yl] N-(3,5-dimethyl-1-adamantyl)carbamate?
The canonical SMILES for [5-[[methyl(prop-2-ynyl)amino]methyl]quinolin-8-yl] N-(3,5-dimethyl-1-adamantyl)carbamate is C#CCN(C)Cc1ccc(OC(=O)NC23CC4CC(C)(CC(C)(C4)C2)C3)c2ncccc12.
What is the InChIKey of [5-[[methyl(prop-2-ynyl)amino]methyl]quinolin-8-yl] N-(3,5-dimethyl-1-adamantyl)carbamate?
The InChIKey is DNQHATJXXBVTPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H33N3O2/c1-5-11-30(4)15-20-8-9-22(23-21(20)7-6-10-28-23)32-24(31)29-27-14-19-12-25(2,17-27)16-26(3,13-19)18-27/h1,6-10,19H,11-18H2,2-4H3,(H,29,31).
What are the key properties of [5-[[methyl(prop-2-ynyl)amino]methyl]quinolin-8-yl] N-(3,5-dimethyl-1-adamantyl)carbamate?
[5-[[methyl(prop-2-ynyl)amino]methyl]quinolin-8-yl] N-(3,5-dimethyl-1-adamantyl)carbamate has a molecular weight of 431.58 g/mol, XLogP of 5.14, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[[methyl(prop-2-ynyl)amino]methyl]quinolin-8-yl] N-(3,5-dimethyl-1-adamantyl)carbamate is sourced from PubChem (CID 46861941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).