C13H12ClN5O4 — CID 168880203
methyl N-[4-[[4-chloro-5-(methylamino)-6-nitroso-3-pyridinyl]oxy]-2-pyridinyl]carbamate (PubChem CID 168880203) has the molecular formula C13H12ClN5O4 and a molecular weight of 337.72 g/mol. Its IUPAC name is methyl N-[4-[[4-chloro-5-(methylamino)-6-nitroso-3-pyridinyl]oxy]-2-pyridinyl]carbamate.
| Compound Name | methyl N-[4-[[4-chloro-5-(methylamino)-6-nitroso-3-pyridinyl]oxy]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 168880203 |
| Molecular Formula | C13H12ClN5O4 |
| Molecular Weight | 337.72 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | methyl N-[4-[[4-chloro-5-(methylamino)-6-nitroso-3-pyridinyl]oxy]-2-pyridinyl]carbamate |
| SMILES | CNc1c(N=O)ncc(Oc2ccnc(NC(=O)OC)c2)c1Cl |
| InChI | InChI=1S/C13H12ClN5O4/c1-15-11-10(14)8(6-17-12(11)19-21)23-7-3-4-16-9(5-7)18-13(20)22-2/h3-6,15H,1-2H3,(H,16,18,20) |
| InChIKey | DYWNUEOTDXOMJC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 114.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.72 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |