C14H29F2N — CID 168880780
2-butyl-4,4-difluoro-N-methyl-2-propylhexan-1-amine (PubChem CID 168880780) has the molecular formula C14H29F2N and a molecular weight of 249.39 g/mol. Its IUPAC name is 2-butyl-4,4-difluoro-N-methyl-2-propylhexan-1-amine.
| Compound Name | 2-butyl-4,4-difluoro-N-methyl-2-propylhexan-1-amine |
|---|---|
| PubChem CID | 168880780 |
| Molecular Formula | C14H29F2N |
| Molecular Weight | 249.39 g/mol |
| Exact Mass | 249.23 |
| IUPAC Name | 2-butyl-4,4-difluoro-N-methyl-2-propylhexan-1-amine |
| SMILES | CCCCC(CCC)(CNC)CC(F)(F)CC |
| InChI | InChI=1S/C14H29F2N/c1-5-8-10-13(9-6-2,12-17-4)11-14(15,16)7-3/h17H,5-12H2,1-4H3 |
| InChIKey | ZNCIPKQKHWMAGX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |