C17H16BrFO5S — CID 168884576
[(2R)-5-bromo-4-fluoro-6-phenylmethoxy-2,3-dihydro-1-benzofuran-2-yl]methyl methanesulfonate (PubChem CID 168884576) has the molecular formula C17H16BrFO5S and a molecular weight of 431.28 g/mol. Its IUPAC name is [(2R)-5-bromo-4-fluoro-6-phenylmethoxy-2,3-dihydro-1-benzofuran-2-yl]methyl methanesulfonate.
| Compound Name | [(2R)-5-bromo-4-fluoro-6-phenylmethoxy-2,3-dihydro-1-benzofuran-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 168884576 |
| Molecular Formula | C17H16BrFO5S |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 429.99 |
| IUPAC Name | [(2R)-5-bromo-4-fluoro-6-phenylmethoxy-2,3-dihydro-1-benzofuran-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H]1Cc2c(cc(OCc3ccccc3)c(Br)c2F)O1 |
| InChI | InChI=1S/C17H16BrFO5S/c1-25(20,21)23-10-12-7-13-14(24-12)8-15(16(18)17(13)19)22-9-11-5-3-2-4-6-11/h2-6,8,12H,7,9-10H2,1H3/t12-/m1/s1 |
| InChIKey | RISNQJDURNJCKA-GFCCVEGCSA-N |
| XLogP | 3.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|