C12H21NO6 — CID 168884911
(1-hydroxy-3-propanoyloxypropan-2-yl) 3-(3-oxopropylamino)propanoate (PubChem CID 168884911) has the molecular formula C12H21NO6 and a molecular weight of 275.30 g/mol. Its IUPAC name is (1-hydroxy-3-propanoyloxypropan-2-yl) 3-(3-oxopropylamino)propanoate.
| Compound Name | (1-hydroxy-3-propanoyloxypropan-2-yl) 3-(3-oxopropylamino)propanoate |
|---|---|
| PubChem CID | 168884911 |
| Molecular Formula | C12H21NO6 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | (1-hydroxy-3-propanoyloxypropan-2-yl) 3-(3-oxopropylamino)propanoate |
| SMILES | CCC(=O)OCC(CO)OC(=O)CCNCCC=O |
| InChI | InChI=1S/C12H21NO6/c1-2-11(16)18-9-10(8-15)19-12(17)4-6-13-5-3-7-14/h7,10,13,15H,2-6,8-9H2,1H3 |
| InChIKey | NMLHIKDAHMLLSA-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|