C21H37NO6 — CID 168884963
[3-hydroxy-2-[4-(4-oxobutylamino)butanoyloxy]propyl] 4-cyclohexylbutanoate (PubChem CID 168884963) has the molecular formula C21H37NO6 and a molecular weight of 399.53 g/mol. Its IUPAC name is [3-hydroxy-2-[4-(4-oxobutylamino)butanoyloxy]propyl] 4-cyclohexylbutanoate.
| Compound Name | [3-hydroxy-2-[4-(4-oxobutylamino)butanoyloxy]propyl] 4-cyclohexylbutanoate |
|---|---|
| PubChem CID | 168884963 |
| Molecular Formula | C21H37NO6 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | [3-hydroxy-2-[4-(4-oxobutylamino)butanoyloxy]propyl] 4-cyclohexylbutanoate |
| SMILES | O=CCCCNCCCC(=O)OC(CO)COC(=O)CCCC1CCCCC1 |
| InChI | InChI=1S/C21H37NO6/c23-15-5-4-13-22-14-7-12-21(26)28-19(16-24)17-27-20(25)11-6-10-18-8-2-1-3-9-18/h15,18-19,22,24H,1-14,16-17H2 |
| InChIKey | KLQOJGBGNVEMEE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|