C54H93NO12 — CID 168884681
[2-[4-[[4-[1,3-bis[(3-cyclohexyl-2-methylpropanoyl)oxy]propan-2-yloxy]-4-oxobutyl]amino]-1-hydroxybutoxy]-3-(3-cyclohexyl-2-methylpropanoyl)oxypropyl] 3-cyclohexyl-2-methylpropanoate (PubChem CID 168884681) has the molecular formula C54H93NO12 and a molecular weight of 948.33 g/mol. Its IUPAC name is [2-[4-[[4-[1,3-bis[(3-cyclohexyl-2-methylpropanoyl)oxy]propan-2-yloxy]-4-oxobutyl]amino]-1-hydroxybutoxy]-3-(3-cyclohexyl-2-methylpropanoyl)oxypropyl] 3-cyclohexyl-2-methylpropanoate.
| Compound Name | [2-[4-[[4-[1,3-bis[(3-cyclohexyl-2-methylpropanoyl)oxy]propan-2-yloxy]-4-oxobutyl]amino]-1-hydroxybutoxy]-3-(3-cyclohexyl-2-methylpropanoyl)oxypropyl] 3-cyclohexyl-2-methylpropanoate |
|---|---|
| PubChem CID | 168884681 |
| Molecular Formula | C54H93NO12 |
| Molecular Weight | 948.33 g/mol |
| Exact Mass | 947.67 |
| IUPAC Name | [2-[4-[[4-[1,3-bis[(3-cyclohexyl-2-methylpropanoyl)oxy]propan-2-yloxy]-4-oxobutyl]amino]-1-hydroxybutoxy]-3-(3-cyclohexyl-2-methylpropanoyl)oxypropyl] 3-cyclohexyl-2-methylpropanoate |
| SMILES | CC(CC1CCCCC1)C(=O)OCC(COC(=O)C(C)CC1CCCCC1)OC(=O)CCCNCCCC(O)OC(COC(=O)C(C)CC1CCCCC1)COC(=O)C(C)CC1CCCCC1 |
| InChI | InChI=1S/C54H93NO12/c1-39(31-43-19-9-5-10-20-43)51(58)62-35-47(36-63-52(59)40(2)32-44-21-11-6-12-22-44)66-49(56)27-17-29-55-30-18-28-50(57)67-48(37-64-53(60)41(3)33-45-23-13-7-14-24-45)38-65-54(61)42(4)34-46-25-15-8-16-26-46/h39-49,55-56H,5-38H2,1-4H3 |
| InChIKey | CTWHCJDOBQVQEW-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 172.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.33 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|