C20H31N3O — CID 168886876
(Z)-2-[3-(3,3-dimethylbutoxy)phenyl]-3-piperidin-4-yliminoprop-1-en-1-amine (PubChem CID 168886876) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is (Z)-2-[3-(3,3-dimethylbutoxy)phenyl]-3-piperidin-4-yliminoprop-1-en-1-amine.
| Compound Name | (Z)-2-[3-(3,3-dimethylbutoxy)phenyl]-3-piperidin-4-yliminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 168886876 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | (Z)-2-[3-(3,3-dimethylbutoxy)phenyl]-3-piperidin-4-yliminoprop-1-en-1-amine |
| SMILES | CC(C)(C)CCOc1cccc(C(=C/N)/C=N/C2CCNCC2)c1 |
| InChI | InChI=1S/C20H31N3O/c1-20(2,3)9-12-24-19-6-4-5-16(13-19)17(14-21)15-23-18-7-10-22-11-8-18/h4-6,13-15,18,22H,7-12,21H2,1-3H3/b17-14+,23-15+ |
| InChIKey | IETWPZHNEGFXEP-KWAFQGHKSA-N |
| XLogP | 3.62 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|