C15H32N2O2 — CID 168888436
(E)-4-methyl-N-[6-(propanoylamino)hexyl]pent-2-enamide;molecular hydrogen (PubChem CID 168888436) has the molecular formula C15H32N2O2 and a molecular weight of 272.43 g/mol. Its IUPAC name is (E)-4-methyl-N-[6-(propanoylamino)hexyl]pent-2-enamide;molecular hydrogen.
| Compound Name | (E)-4-methyl-N-[6-(propanoylamino)hexyl]pent-2-enamide;molecular hydrogen |
|---|---|
| PubChem CID | 168888436 |
| Molecular Formula | C15H32N2O2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | (E)-4-methyl-N-[6-(propanoylamino)hexyl]pent-2-enamide;molecular hydrogen |
| SMILES | CCC(=O)NCCCCCCNC(=O)/C=C/C(C)C.[H][H].[H][H] |
| InChI | InChI=1S/C15H28N2O2.2H2/c1-4-14(18)16-11-7-5-6-8-12-17-15(19)10-9-13(2)3;;/h9-10,13H,4-8,11-12H2,1-3H3,(H,16,18)(H,17,19);2*1H/b10-9+;; |
| InChIKey | NPAILTYFBPUUGX-TTWKNDKESA-N |
| XLogP | 2.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|