C23H22F3N5O3S2 — CID 168889105
7-[2-[(6-ethyl-2,3-dihydro-1H-isoindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one (PubChem CID 168889105) has the molecular formula C23H22F3N5O3S2 and a molecular weight of 537.59 g/mol. Its IUPAC name is 7-[2-[(6-ethyl-2,3-dihydro-1H-isoindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one.
| Compound Name | 7-[2-[(6-ethyl-2,3-dihydro-1H-isoindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 168889105 |
| Molecular Formula | C23H22F3N5O3S2 |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | 7-[2-[(6-ethyl-2,3-dihydro-1H-isoindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-1,1-dioxo-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
| SMILES | CCc1cc2c(cc1Nc1ncc(C(F)(F)F)c(-c3cc4c(s3)C(=O)N(C)CCS4(=O)=O)n1)CNC2 |
| InChI | InChI=1S/C23H22F3N5O3S2/c1-3-12-6-13-9-27-10-14(13)7-16(12)29-22-28-11-15(23(24,25)26)19(30-22)17-8-18-20(35-17)21(32)31(2)4-5-36(18,33)34/h6-8,11,27H,3-5,9-10H2,1-2H3,(H,28,29,30) |
| InChIKey | MLFKHHVYTSSMDQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |