C15H27N3O3S — CID 168890437
tert-butyl 3-[[(Z)-2-amino-3-sulfanylprop-2-enoyl]-ethylamino]piperidine-1-carboxylate (PubChem CID 168890437) has the molecular formula C15H27N3O3S and a molecular weight of 329.47 g/mol. Its IUPAC name is tert-butyl 3-[[(Z)-2-amino-3-sulfanylprop-2-enoyl]-ethylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[(Z)-2-amino-3-sulfanylprop-2-enoyl]-ethylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168890437 |
| Molecular Formula | C15H27N3O3S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | tert-butyl 3-[[(Z)-2-amino-3-sulfanylprop-2-enoyl]-ethylamino]piperidine-1-carboxylate |
| SMILES | CCN(C(=O)/C(N)=C/S)C1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H27N3O3S/c1-5-18(13(19)12(16)10-22)11-7-6-8-17(9-11)14(20)21-15(2,3)4/h10-11,22H,5-9,16H2,1-4H3/b12-10- |
| InChIKey | DUKMYUULLYNTEB-BENRWUELSA-N |
| XLogP | 1.96 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|