C14H18N4O2 — CID 168890484
N-(piperidin-4-ylmethyl)-5-(1H-pyrazol-4-yl)furan-2-carboxamide (PubChem CID 168890484) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-(piperidin-4-ylmethyl)-5-(1H-pyrazol-4-yl)furan-2-carboxamide.
| Compound Name | N-(piperidin-4-ylmethyl)-5-(1H-pyrazol-4-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 168890484 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N-(piperidin-4-ylmethyl)-5-(1H-pyrazol-4-yl)furan-2-carboxamide |
| SMILES | O=C(NCC1CCNCC1)c1ccc(-c2cn[nH]c2)o1 |
| InChI | InChI=1S/C14H18N4O2/c19-14(16-7-10-3-5-15-6-4-10)13-2-1-12(20-13)11-8-17-18-9-11/h1-2,8-10,15H,3-7H2,(H,16,19)(H,17,18) |
| InChIKey | RXHHPLRUHLNGPU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |