C16H9F3O5 — CID 168891087
3,6,7-trihydroxy-2-[4-(trifluoromethyl)phenyl]chromen-4-one (PubChem CID 168891087) has the molecular formula C16H9F3O5 and a molecular weight of 338.24 g/mol. Its IUPAC name is 3,6,7-trihydroxy-2-[4-(trifluoromethyl)phenyl]chromen-4-one.
| Compound Name | 3,6,7-trihydroxy-2-[4-(trifluoromethyl)phenyl]chromen-4-one |
|---|---|
| PubChem CID | 168891087 |
| Molecular Formula | C16H9F3O5 |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 3,6,7-trihydroxy-2-[4-(trifluoromethyl)phenyl]chromen-4-one |
| SMILES | O=c1c(O)c(-c2ccc(C(F)(F)F)cc2)oc2cc(O)c(O)cc12 |
| InChI | InChI=1S/C16H9F3O5/c17-16(18,19)8-3-1-7(2-4-8)15-14(23)13(22)9-5-10(20)11(21)6-12(9)24-15/h1-6,20-21,23H |
| InChIKey | GPLJHJPOEQRAQU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|