C11H12ClN5O2 — CID 168891321
N-[5-chloro-6-[4-(2-hydroxypropan-2-yl)triazol-2-yl]-3-pyridinyl]formamide (PubChem CID 168891321) has the molecular formula C11H12ClN5O2 and a molecular weight of 281.70 g/mol. Its IUPAC name is N-[5-chloro-6-[4-(2-hydroxypropan-2-yl)triazol-2-yl]-3-pyridinyl]formamide.
| Compound Name | N-[5-chloro-6-[4-(2-hydroxypropan-2-yl)triazol-2-yl]-3-pyridinyl]formamide |
|---|---|
| PubChem CID | 168891321 |
| Molecular Formula | C11H12ClN5O2 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N-[5-chloro-6-[4-(2-hydroxypropan-2-yl)triazol-2-yl]-3-pyridinyl]formamide |
| SMILES | CC(C)(O)c1cnn(-c2ncc(NC=O)cc2Cl)n1 |
| InChI | InChI=1S/C11H12ClN5O2/c1-11(2,19)9-5-15-17(16-9)10-8(12)3-7(4-13-10)14-6-18/h3-6,19H,1-2H3,(H,14,18) |
| InChIKey | CYVDRJQUSOOIGL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|