C28H34Cl2N8O2Si — CID 174059521
N-[6-[4-[1-[tert-butyl(dimethyl)silyl]oxyethyl]triazol-2-yl]-5-chloro-3-pyridinyl]-11-chlorospiro[1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3,1'-cyclobutane]-5-carboxamide (PubChem CID 174059521) has the molecular formula C28H34Cl2N8O2Si and a molecular weight of 613.63 g/mol. Its IUPAC name is N-[6-[4-[1-[tert-butyl(dimethyl)silyl]oxyethyl]triazol-2-yl]-5-chloro-3-pyridinyl]-11-chlorospiro[1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3,1'-cyclobutane]-5-carboxamide.
| Compound Name | N-[6-[4-[1-[tert-butyl(dimethyl)silyl]oxyethyl]triazol-2-yl]-5-chloro-3-pyridinyl]-11-chlorospiro[1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3,1'-cyclobutane]-5-carboxamide |
|---|---|
| PubChem CID | 174059521 |
| Molecular Formula | C28H34Cl2N8O2Si |
| Molecular Weight | 613.63 g/mol |
| Exact Mass | 612.20 |
| IUPAC Name | N-[6-[4-[1-[tert-butyl(dimethyl)silyl]oxyethyl]triazol-2-yl]-5-chloro-3-pyridinyl]-11-chlorospiro[1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3,1'-cyclobutane]-5-carboxamide |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)c1cnn(-c2ncc(NC(=O)C3CC4(CCC4)c4c3cnc3cc(Cl)nn43)cc2Cl)n1 |
| InChI | InChI=1S/C28H34Cl2N8O2Si/c1-16(40-41(5,6)27(2,3)4)21-15-33-38(35-21)25-20(29)10-17(13-32-25)34-26(39)18-12-28(8-7-9-28)24-19(18)14-31-23-11-22(30)36-37(23)24/h10-11,13-16,18H,7-9,12H2,1-6H3,(H,34,39) |
| InChIKey | ILZGERPLQIVXHJ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 112.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.63 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|