C50H99NO5 — CID 168892113
4-pentylnonyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(1-hydroxypropan-2-yl)amino]octanoate (PubChem CID 168892113) has the molecular formula C50H99NO5 and a molecular weight of 794.34 g/mol. Its IUPAC name is 4-pentylnonyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(1-hydroxypropan-2-yl)amino]octanoate.
| Compound Name | 4-pentylnonyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(1-hydroxypropan-2-yl)amino]octanoate |
|---|---|
| PubChem CID | 168892113 |
| Molecular Formula | C50H99NO5 |
| Molecular Weight | 794.34 g/mol |
| Exact Mass | 793.75 |
| IUPAC Name | 4-pentylnonyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(1-hydroxypropan-2-yl)amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OCCCC(CCCCC)CCCCC)C(C)CO |
| InChI | InChI=1S/C50H99NO5/c1-6-10-14-16-20-28-38-48(39-29-21-17-15-11-7-2)56-50(54)41-31-23-19-25-33-43-51(46(5)45-52)42-32-24-18-22-30-40-49(53)55-44-34-37-47(35-26-12-8-3)36-27-13-9-4/h46-48,52H,6-45H2,1-5H3 |
| InChIKey | FHUFYISRQBVQJO-UHFFFAOYSA-N |
| XLogP | 14.86 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.34 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|