C41H81NO5 — CID 155278430
hexyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-(1-hydroxypropan-2-yl)amino]octanoate (PubChem CID 155278430) has the molecular formula C41H81NO5 and a molecular weight of 668.10 g/mol. Its IUPAC name is hexyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-(1-hydroxypropan-2-yl)amino]octanoate.
| Compound Name | hexyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-(1-hydroxypropan-2-yl)amino]octanoate |
|---|---|
| PubChem CID | 155278430 |
| Molecular Formula | C41H81NO5 |
| Molecular Weight | 668.10 g/mol |
| Exact Mass | 667.61 |
| IUPAC Name | hexyl 8-[(8-hexadecan-8-yloxy-8-oxooctyl)-(1-hydroxypropan-2-yl)amino]octanoate |
| SMILES | CCCCCCCCC(CCCCCCC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OCCCCCC)C(C)CO |
| InChI | InChI=1S/C41H81NO5/c1-5-8-11-14-18-24-31-39(30-23-17-12-9-6-2)47-41(45)33-26-20-16-22-28-35-42(38(4)37-43)34-27-21-15-19-25-32-40(44)46-36-29-13-10-7-3/h38-39,43H,5-37H2,1-4H3 |
| InChIKey | CDUAEMDUABNBLW-UHFFFAOYSA-N |
| XLogP | 11.50 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.10 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|