C14H17F2N3O — CID 168892531
1-[(2S)-2-bicyclo[2.2.0]hexanyl]-3-[[2-(difluoromethyl)-4-pyridinyl]methyl]urea (PubChem CID 168892531) has the molecular formula C14H17F2N3O and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-[(2S)-2-bicyclo[2.2.0]hexanyl]-3-[[2-(difluoromethyl)-4-pyridinyl]methyl]urea.
| Compound Name | 1-[(2S)-2-bicyclo[2.2.0]hexanyl]-3-[[2-(difluoromethyl)-4-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 168892531 |
| Molecular Formula | C14H17F2N3O |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 1-[(2S)-2-bicyclo[2.2.0]hexanyl]-3-[[2-(difluoromethyl)-4-pyridinyl]methyl]urea |
| SMILES | O=C(NCc1ccnc(C(F)F)c1)N[C@H]1CC2CCC21 |
| InChI | InChI=1S/C14H17F2N3O/c15-13(16)12-5-8(3-4-17-12)7-18-14(20)19-11-6-9-1-2-10(9)11/h3-5,9-11,13H,1-2,6-7H2,(H2,18,19,20)/t9?,10?,11-/m0/s1 |
| InChIKey | ZXIUVRAYSLUGSM-ILDUYXDCSA-N |
| XLogP | 2.62 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |