C20H27NO6 — CID 168896652
methyl 3-methyl-2-[3-[2-(2-phenylmethoxyethoxy)ethoxy]-1,2-oxazol-5-yl]butanoate (PubChem CID 168896652) has the molecular formula C20H27NO6 and a molecular weight of 377.44 g/mol. Its IUPAC name is methyl 3-methyl-2-[3-[2-(2-phenylmethoxyethoxy)ethoxy]-1,2-oxazol-5-yl]butanoate.
| Compound Name | methyl 3-methyl-2-[3-[2-(2-phenylmethoxyethoxy)ethoxy]-1,2-oxazol-5-yl]butanoate |
|---|---|
| PubChem CID | 168896652 |
| Molecular Formula | C20H27NO6 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | methyl 3-methyl-2-[3-[2-(2-phenylmethoxyethoxy)ethoxy]-1,2-oxazol-5-yl]butanoate |
| SMILES | COC(=O)C(c1cc(OCCOCCOCc2ccccc2)no1)C(C)C |
| InChI | InChI=1S/C20H27NO6/c1-15(2)19(20(22)23-3)17-13-18(21-27-17)26-12-11-24-9-10-25-14-16-7-5-4-6-8-16/h4-8,13,15,19H,9-12,14H2,1-3H3 |
| InChIKey | OVFDFSNLNYXRGX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 80.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|