C25H36BNO7 — CID 140881952
methyl 3-methyl-2-[3-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]butoxy]-1,2-oxazol-5-yl]butanoate (PubChem CID 140881952) has the molecular formula C25H36BNO7 and a molecular weight of 473.38 g/mol. Its IUPAC name is methyl 3-methyl-2-[3-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]butoxy]-1,2-oxazol-5-yl]butanoate.
| Compound Name | methyl 3-methyl-2-[3-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]butoxy]-1,2-oxazol-5-yl]butanoate |
|---|---|
| PubChem CID | 140881952 |
| Molecular Formula | C25H36BNO7 |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | methyl 3-methyl-2-[3-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]butoxy]-1,2-oxazol-5-yl]butanoate |
| SMILES | COC(=O)C(c1cc(OCCCCOc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)no1)C(C)C |
| InChI | InChI=1S/C25H36BNO7/c1-17(2)22(23(28)29-7)20-16-21(27-32-20)31-15-9-8-14-30-19-12-10-18(11-13-19)26-33-24(3,4)25(5,6)34-26/h10-13,16-17,22H,8-9,14-15H2,1-7H3 |
| InChIKey | TYVATZHENYVMFY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 89.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|