C23H27FN2OS — CID 168898240
cyclopropyl-[6-[1-(4-fluorophenyl)ethylamino]sulfanyl-4,4-dimethyl-1,3-dihydroisoquinolin-2-yl]methanone (PubChem CID 168898240) has the molecular formula C23H27FN2OS and a molecular weight of 398.55 g/mol. Its IUPAC name is cyclopropyl-[6-[1-(4-fluorophenyl)ethylamino]sulfanyl-4,4-dimethyl-1,3-dihydroisoquinolin-2-yl]methanone.
| Compound Name | cyclopropyl-[6-[1-(4-fluorophenyl)ethylamino]sulfanyl-4,4-dimethyl-1,3-dihydroisoquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 168898240 |
| Molecular Formula | C23H27FN2OS |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | cyclopropyl-[6-[1-(4-fluorophenyl)ethylamino]sulfanyl-4,4-dimethyl-1,3-dihydroisoquinolin-2-yl]methanone |
| SMILES | CC(NSc1ccc2c(c1)C(C)(C)CN(C(=O)C1CC1)C2)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H27FN2OS/c1-15(16-6-9-19(24)10-7-16)25-28-20-11-8-18-13-26(22(27)17-4-5-17)14-23(2,3)21(18)12-20/h6-12,15,17,25H,4-5,13-14H2,1-3H3 |
| InChIKey | UWKQAWYNKYTSLR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|