C37H38N2O10S2 — CID 168899407
[3-(cyclohexylmethoxy)-2-methyl-5-(4-methylphenyl)sulfonyloxy-4-(4-nitro-1,3-dihydroisoindole-2-carbonyl)phenyl] 4-methylbenzenesulfonate (PubChem CID 168899407) has the molecular formula C37H38N2O10S2 and a molecular weight of 734.85 g/mol. Its IUPAC name is [3-(cyclohexylmethoxy)-2-methyl-5-(4-methylphenyl)sulfonyloxy-4-(4-nitro-1,3-dihydroisoindole-2-carbonyl)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [3-(cyclohexylmethoxy)-2-methyl-5-(4-methylphenyl)sulfonyloxy-4-(4-nitro-1,3-dihydroisoindole-2-carbonyl)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 168899407 |
| Molecular Formula | C37H38N2O10S2 |
| Molecular Weight | 734.85 g/mol |
| Exact Mass | 734.20 |
| IUPAC Name | [3-(cyclohexylmethoxy)-2-methyl-5-(4-methylphenyl)sulfonyloxy-4-(4-nitro-1,3-dihydroisoindole-2-carbonyl)phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cc(OS(=O)(=O)c3ccc(C)cc3)c(C(=O)N3Cc4cccc([N+](=O)[O-])c4C3)c(OCC3CCCCC3)c2C)cc1 |
| InChI | InChI=1S/C37H38N2O10S2/c1-24-12-16-29(17-13-24)50(43,44)48-33-20-34(49-51(45,46)30-18-14-25(2)15-19-30)35(36(26(33)3)47-23-27-8-5-4-6-9-27)37(40)38-21-28-10-7-11-32(39(41)42)31(28)22-38/h7,10-20,27H,4-6,8-9,21-23H2,1-3H3 |
| InChIKey | RRGVQNPJWRAAPP-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 159.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.85 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|