C26H41NO5 — CID 168899778
2-(3-ethyl-4-propanoylphenyl)-N-(2-methoxyethyl)acetamide;3-methylnonane-2,6-dione (PubChem CID 168899778) has the molecular formula C26H41NO5 and a molecular weight of 447.62 g/mol. Its IUPAC name is 2-(3-ethyl-4-propanoylphenyl)-N-(2-methoxyethyl)acetamide;3-methylnonane-2,6-dione.
| Compound Name | 2-(3-ethyl-4-propanoylphenyl)-N-(2-methoxyethyl)acetamide;3-methylnonane-2,6-dione |
|---|---|
| PubChem CID | 168899778 |
| Molecular Formula | C26H41NO5 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | 2-(3-ethyl-4-propanoylphenyl)-N-(2-methoxyethyl)acetamide;3-methylnonane-2,6-dione |
| SMILES | CCC(=O)c1ccc(CC(=O)NCCOC)cc1CC.CCCC(=O)CCC(C)C(C)=O |
| InChI | InChI=1S/C16H23NO3.C10H18O2/c1-4-13-10-12(6-7-14(13)15(18)5-2)11-16(19)17-8-9-20-3;1-4-5-10(12)7-6-8(2)9(3)11/h6-7,10H,4-5,8-9,11H2,1-3H3,(H,17,19);8H,4-7H2,1-3H3 |
| InChIKey | UETDFFOMUGIVOJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|