C22H33BrO2 — CID 155584725
1-(4-bromo-2-ethylphenyl)-2-methylpropan-1-one;6,7-dimethyloct-7-en-3-one (PubChem CID 155584725) has the molecular formula C22H33BrO2 and a molecular weight of 409.41 g/mol. Its IUPAC name is 1-(4-bromo-2-ethylphenyl)-2-methylpropan-1-one;6,7-dimethyloct-7-en-3-one.
| Compound Name | 1-(4-bromo-2-ethylphenyl)-2-methylpropan-1-one;6,7-dimethyloct-7-en-3-one |
|---|---|
| PubChem CID | 155584725 |
| Molecular Formula | C22H33BrO2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1-(4-bromo-2-ethylphenyl)-2-methylpropan-1-one;6,7-dimethyloct-7-en-3-one |
| SMILES | C=C(C)C(C)CCC(=O)CC.CCc1cc(Br)ccc1C(=O)C(C)C |
| InChI | InChI=1S/C12H15BrO.C10H18O/c1-4-9-7-10(13)5-6-11(9)12(14)8(2)3;1-5-10(11)7-6-9(4)8(2)3/h5-8H,4H2,1-3H3;9H,2,5-7H2,1,3-4H3 |
| InChIKey | WKTRKTREIBVIRD-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|