C29H41N3O5 — CID 170731836
N-[3-ethyl-4-(2-methylpropanoyl)phenyl]-4-(2-hydroxy-2-methylhydrazinyl)benzamide;3-methyloctane-2,6-dione (PubChem CID 170731836) has the molecular formula C29H41N3O5 and a molecular weight of 511.66 g/mol. Its IUPAC name is N-[3-ethyl-4-(2-methylpropanoyl)phenyl]-4-(2-hydroxy-2-methylhydrazinyl)benzamide;3-methyloctane-2,6-dione.
| Compound Name | N-[3-ethyl-4-(2-methylpropanoyl)phenyl]-4-(2-hydroxy-2-methylhydrazinyl)benzamide;3-methyloctane-2,6-dione |
|---|---|
| PubChem CID | 170731836 |
| Molecular Formula | C29H41N3O5 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | N-[3-ethyl-4-(2-methylpropanoyl)phenyl]-4-(2-hydroxy-2-methylhydrazinyl)benzamide;3-methyloctane-2,6-dione |
| SMILES | CCC(=O)CCC(C)C(C)=O.CCc1cc(NC(=O)c2ccc(NN(C)O)cc2)ccc1C(=O)C(C)C |
| InChI | InChI=1S/C20H25N3O3.C9H16O2/c1-5-14-12-17(10-11-18(14)19(24)13(2)3)21-20(25)15-6-8-16(9-7-15)22-23(4)26;1-4-9(11)6-5-7(2)8(3)10/h6-13,22,26H,5H2,1-4H3,(H,21,25);7H,4-6H2,1-3H3 |
| InChIKey | QXJFGIIXFUSOFC-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|