C48H84N6O10 — CID 158781560
1-N,3-N-bis[1,5-bis(6-methoxyhexylamino)-1,5-dioxopentan-2-yl]-5-ethylbenzene-1,3-dicarboxamide (PubChem CID 158781560) has the molecular formula C48H84N6O10 and a molecular weight of 905.23 g/mol. Its IUPAC name is 1-N,3-N-bis[1,5-bis(6-methoxyhexylamino)-1,5-dioxopentan-2-yl]-5-ethylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[1,5-bis(6-methoxyhexylamino)-1,5-dioxopentan-2-yl]-5-ethylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 158781560 |
| Molecular Formula | C48H84N6O10 |
| Molecular Weight | 905.23 g/mol |
| Exact Mass | 904.62 |
| IUPAC Name | 1-N,3-N-bis[1,5-bis(6-methoxyhexylamino)-1,5-dioxopentan-2-yl]-5-ethylbenzene-1,3-dicarboxamide |
| SMILES | CCc1cc(C(=O)NC(CCC(=O)NCCCCCCOC)C(=O)NCCCCCCOC)cc(C(=O)NC(CCC(=O)NCCCCCCOC)C(=O)NCCCCCCOC)c1 |
| InChI | InChI=1S/C48H84N6O10/c1-6-38-35-39(45(57)53-41(47(59)51-29-17-9-13-21-33-63-4)23-25-43(55)49-27-15-7-11-19-31-61-2)37-40(36-38)46(58)54-42(48(60)52-30-18-10-14-22-34-64-5)24-26-44(56)50-28-16-8-12-20-32-62-3/h35-37,41-42H,6-34H2,1-5H3,(H,49,55)(H,50,56)(H,51,59)(H,52,60)(H,53,57)(H,54,58) |
| InChIKey | UXGPRIVLVZBMBO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 211.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.23 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|