C24H26N2O3S — CID 16890214
N-[2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]ethyl]-4-methoxybenzenesulfonamide (PubChem CID 16890214) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is N-[2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]ethyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]ethyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 16890214 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-[2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]ethyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCc2ccc(N3CCc4ccccc4C3)cc2)cc1 |
| InChI | InChI=1S/C24H26N2O3S/c1-29-23-10-12-24(13-11-23)30(27,28)25-16-14-19-6-8-22(9-7-19)26-17-15-20-4-2-3-5-21(20)18-26/h2-13,25H,14-18H2,1H3 |
| InChIKey | YVYSDYCBPZEURB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|