C26H30N2O4S — CID 16890676
N-[3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]propyl]-2,4-dimethoxybenzenesulfonamide (PubChem CID 16890676) has the molecular formula C26H30N2O4S and a molecular weight of 466.60 g/mol. Its IUPAC name is N-[3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]propyl]-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]propyl]-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 16890676 |
| Molecular Formula | C26H30N2O4S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | N-[3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)phenyl]propyl]-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCCc2ccc(N3CCc4ccccc4C3)cc2)c(OC)c1 |
| InChI | InChI=1S/C26H30N2O4S/c1-31-24-13-14-26(25(18-24)32-2)33(29,30)27-16-5-6-20-9-11-23(12-10-20)28-17-15-21-7-3-4-8-22(21)19-28/h3-4,7-14,18,27H,5-6,15-17,19H2,1-2H3 |
| InChIKey | OORNADAHSDPNNZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|