About CID 168904100
CID 168904100 (PubChem CID 168904100) has the molecular formula C21H24OSi-
and a molecular weight of 320.51 g/mol.
Molecular Properties
| Compound Name | CID 168904100 |
| PubChem CID | 168904100 |
| Molecular Formula | C21H24OSi- |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | — |
| SMILES | C[Si-](OCC1CC2C=CC1C2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24OSi/c1-23(20-8-4-2-5-9-20,21-10-6-3-7-11-21)22-16-19-15-17-12-13-18(19)14-17/h2-13,17-19H,14-16H2,1H3/q-1 |
| InChIKey | KNKBHAYWOZNVCL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 168904100 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 168904100?
The IUPAC name of CID 168904100 (CID 168904100) is not available.
What is the SMILES notation for CID 168904100?
The canonical SMILES for CID 168904100 is C[Si-](OCC1CC2C=CC1C2)(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 168904100?
The InChIKey is KNKBHAYWOZNVCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24OSi/c1-23(20-8-4-2-5-9-20,21-10-6-3-7-11-21)22-16-19-15-17-12-13-18(19)14-17/h2-13,17-19H,14-16H2,1H3/q-1.
What are the key properties of CID 168904100?
CID 168904100 has a molecular weight of 320.51 g/mol, XLogP of 3.60, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 168904100 is sourced from PubChem (CID 168904100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).