C21H23ClF3N3O2S — CID 168904556
2-chloro-N-methyl-N-[[5-methyl-4-prop-1-ynylsulfanyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]methyl]acetamide;ethane (PubChem CID 168904556) has the molecular formula C21H23ClF3N3O2S and a molecular weight of 473.95 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-[[5-methyl-4-prop-1-ynylsulfanyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]methyl]acetamide;ethane.
| Compound Name | 2-chloro-N-methyl-N-[[5-methyl-4-prop-1-ynylsulfanyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]methyl]acetamide;ethane |
|---|---|
| PubChem CID | 168904556 |
| Molecular Formula | C21H23ClF3N3O2S |
| Molecular Weight | 473.95 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 2-chloro-N-methyl-N-[[5-methyl-4-prop-1-ynylsulfanyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]methyl]acetamide;ethane |
| SMILES | CC.CC#CSc1nc(CN(C)C(=O)CCl)nc(-c2ccc(OC(F)(F)F)cc2)c1C |
| InChI | InChI=1S/C19H17ClF3N3O2S.C2H6/c1-4-9-29-18-12(2)17(24-15(25-18)11-26(3)16(27)10-20)13-5-7-14(8-6-13)28-19(21,22)23;1-2/h5-8H,10-11H2,1-3H3;1-2H3 |
| InChIKey | OHDRUYVCFCOVJG-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.95 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|