C23H28F3N3O — CID 168904671
N-but-2-ynyl-2-hexan-3-yl-N,5-dimethyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine (PubChem CID 168904671) has the molecular formula C23H28F3N3O and a molecular weight of 419.49 g/mol. Its IUPAC name is N-but-2-ynyl-2-hexan-3-yl-N,5-dimethyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine.
| Compound Name | N-but-2-ynyl-2-hexan-3-yl-N,5-dimethyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 168904671 |
| Molecular Formula | C23H28F3N3O |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-but-2-ynyl-2-hexan-3-yl-N,5-dimethyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine |
| SMILES | CC#CCN(C)c1nc(C(CC)CCC)nc(-c2ccc(OC(F)(F)F)cc2)c1C |
| InChI | InChI=1S/C23H28F3N3O/c1-6-9-15-29(5)22-16(4)20(27-21(28-22)17(8-3)10-7-2)18-11-13-19(14-12-18)30-23(24,25)26/h11-14,17H,7-8,10,15H2,1-5H3 |
| InChIKey | OYBNWAINKPUEPB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|