C16H14F3N3OS — CID 168904645
[5-methyl-4-prop-1-ynylsulfanyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]methanamine (PubChem CID 168904645) has the molecular formula C16H14F3N3OS and a molecular weight of 353.37 g/mol. Its IUPAC name is [5-methyl-4-prop-1-ynylsulfanyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]methanamine.
| Compound Name | [5-methyl-4-prop-1-ynylsulfanyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]methanamine |
|---|---|
| PubChem CID | 168904645 |
| Molecular Formula | C16H14F3N3OS |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | [5-methyl-4-prop-1-ynylsulfanyl-6-[4-(trifluoromethoxy)phenyl]pyrimidin-2-yl]methanamine |
| SMILES | CC#CSc1nc(CN)nc(-c2ccc(OC(F)(F)F)cc2)c1C |
| InChI | InChI=1S/C16H14F3N3OS/c1-3-8-24-15-10(2)14(21-13(9-20)22-15)11-4-6-12(7-5-11)23-16(17,18)19/h4-7H,9,20H2,1-2H3 |
| InChIKey | FIJJECQXLWNMJR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|