C22H25BrF3NO — CID 168904687
2-bromo-3-ethyl-N,6-dimethyl-N-prop-1-ynyl-5-[4-(trifluoromethoxy)phenyl]aniline;ethane (PubChem CID 168904687) has the molecular formula C22H25BrF3NO and a molecular weight of 456.35 g/mol. Its IUPAC name is 2-bromo-3-ethyl-N,6-dimethyl-N-prop-1-ynyl-5-[4-(trifluoromethoxy)phenyl]aniline;ethane.
| Compound Name | 2-bromo-3-ethyl-N,6-dimethyl-N-prop-1-ynyl-5-[4-(trifluoromethoxy)phenyl]aniline;ethane |
|---|---|
| PubChem CID | 168904687 |
| Molecular Formula | C22H25BrF3NO |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 2-bromo-3-ethyl-N,6-dimethyl-N-prop-1-ynyl-5-[4-(trifluoromethoxy)phenyl]aniline;ethane |
| SMILES | CC.CC#CN(C)c1c(C)c(-c2ccc(OC(F)(F)F)cc2)cc(CC)c1Br |
| InChI | InChI=1S/C20H19BrF3NO.C2H6/c1-5-11-25(4)19-13(3)17(12-14(6-2)18(19)21)15-7-9-16(10-8-15)26-20(22,23)24;1-2/h7-10,12H,6H2,1-4H3;1-2H3 |
| InChIKey | UMKVEBTZEDMPGI-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|