C19H18BrF6NO — CID 139606336
2-[2-bromo-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-N,N,3,5-tetramethylaniline (PubChem CID 139606336) has the molecular formula C19H18BrF6NO and a molecular weight of 470.25 g/mol. Its IUPAC name is 2-[2-bromo-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-N,N,3,5-tetramethylaniline.
| Compound Name | 2-[2-bromo-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-N,N,3,5-tetramethylaniline |
|---|---|
| PubChem CID | 139606336 |
| Molecular Formula | C19H18BrF6NO |
| Molecular Weight | 470.25 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 2-[2-bromo-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-N,N,3,5-tetramethylaniline |
| SMILES | COc1c(C)cc(N(C)C)c(-c2c(Br)cc(C(F)(F)F)cc2C(F)(F)F)c1C |
| InChI | InChI=1S/C19H18BrF6NO/c1-9-6-14(27(3)4)15(10(2)17(9)28-5)16-12(19(24,25)26)7-11(8-13(16)20)18(21,22)23/h6-8H,1-5H3 |
| InChIKey | BCKFUORTOCDVKC-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.25 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|