C17H14BrF6NO — CID 139606348
2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-3,5-bis(trifluoromethyl)aniline (PubChem CID 139606348) has the molecular formula C17H14BrF6NO and a molecular weight of 442.20 g/mol. Its IUPAC name is 2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-3,5-bis(trifluoromethyl)aniline.
| Compound Name | 2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-3,5-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 139606348 |
| Molecular Formula | C17H14BrF6NO |
| Molecular Weight | 442.20 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | 2-(6-bromo-3-methoxy-2,4-dimethylphenyl)-3,5-bis(trifluoromethyl)aniline |
| SMILES | COc1c(C)cc(Br)c(-c2c(N)cc(C(F)(F)F)cc2C(F)(F)F)c1C |
| InChI | InChI=1S/C17H14BrF6NO/c1-7-4-11(18)13(8(2)15(7)26-3)14-10(17(22,23)24)5-9(6-12(14)25)16(19,20)21/h4-6H,25H2,1-3H3 |
| InChIKey | TYWKVWZAWPJNJW-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.20 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|