C29H22BrF6O2P — CID 139617441
1-bromo-2-[2-diphenylphosphoryl-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-3,5-dimethylbenzene (PubChem CID 139617441) has the molecular formula C29H22BrF6O2P and a molecular weight of 627.36 g/mol. Its IUPAC name is 1-bromo-2-[2-diphenylphosphoryl-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-3,5-dimethylbenzene.
| Compound Name | 1-bromo-2-[2-diphenylphosphoryl-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 139617441 |
| Molecular Formula | C29H22BrF6O2P |
| Molecular Weight | 627.36 g/mol |
| Exact Mass | 626.04 |
| IUPAC Name | 1-bromo-2-[2-diphenylphosphoryl-4,6-bis(trifluoromethyl)phenyl]-4-methoxy-3,5-dimethylbenzene |
| SMILES | COc1c(C)cc(Br)c(-c2c(C(F)(F)F)cc(C(F)(F)F)cc2P(=O)(c2ccccc2)c2ccccc2)c1C |
| InChI | InChI=1S/C29H22BrF6O2P/c1-17-14-23(30)25(18(2)27(17)38-3)26-22(29(34,35)36)15-19(28(31,32)33)16-24(26)39(37,20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-16H,1-3H3 |
| InChIKey | WUVGSMVLLLTUNP-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.36 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|