C31H26F3O3P — CID 102110201
ethyl (E)-3-[2-[2-diphenylphosphoryl-4-(trifluoromethyl)phenyl]-3-methylphenyl]prop-2-enoate (PubChem CID 102110201) has the molecular formula C31H26F3O3P and a molecular weight of 534.51 g/mol. Its IUPAC name is ethyl (E)-3-[2-[2-diphenylphosphoryl-4-(trifluoromethyl)phenyl]-3-methylphenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-[2-diphenylphosphoryl-4-(trifluoromethyl)phenyl]-3-methylphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 102110201 |
| Molecular Formula | C31H26F3O3P |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | ethyl (E)-3-[2-[2-diphenylphosphoryl-4-(trifluoromethyl)phenyl]-3-methylphenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cccc(C)c1-c1ccc(C(F)(F)F)cc1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H26F3O3P/c1-3-37-29(35)20-17-23-12-10-11-22(2)30(23)27-19-18-24(31(32,33)34)21-28(27)38(36,25-13-6-4-7-14-25)26-15-8-5-9-16-26/h4-21H,3H2,1-2H3/b20-17+ |
| InChIKey | MHGUURBCXFVKRE-LVZFUZTISA-N |
| XLogP | 6.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|