C15H13F6NO3 — CID 76590475
ethyl 3-[2-(2,2,2-trifluoroethylcarbamoyl)-5-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 76590475) has the molecular formula C15H13F6NO3 and a molecular weight of 369.26 g/mol. Its IUPAC name is ethyl 3-[2-(2,2,2-trifluoroethylcarbamoyl)-5-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[2-(2,2,2-trifluoroethylcarbamoyl)-5-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 76590475 |
| Molecular Formula | C15H13F6NO3 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | ethyl 3-[2-(2,2,2-trifluoroethylcarbamoyl)-5-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1cc(C(F)(F)F)ccc1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C15H13F6NO3/c1-2-25-12(23)6-3-9-7-10(15(19,20)21)4-5-11(9)13(24)22-8-14(16,17)18/h3-7H,2,8H2,1H3,(H,22,24) |
| InChIKey | TWPWYRVONVRTJO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|