C21H24BrF2NO — CID 168904957
2-bromo-5-[4-(1,1-difluoroethyl)phenyl]-N,4-dimethyl-3-[(E)-2-methylbut-1-enoxy]aniline (PubChem CID 168904957) has the molecular formula C21H24BrF2NO and a molecular weight of 424.33 g/mol. Its IUPAC name is 2-bromo-5-[4-(1,1-difluoroethyl)phenyl]-N,4-dimethyl-3-[(E)-2-methylbut-1-enoxy]aniline.
| Compound Name | 2-bromo-5-[4-(1,1-difluoroethyl)phenyl]-N,4-dimethyl-3-[(E)-2-methylbut-1-enoxy]aniline |
|---|---|
| PubChem CID | 168904957 |
| Molecular Formula | C21H24BrF2NO |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 2-bromo-5-[4-(1,1-difluoroethyl)phenyl]-N,4-dimethyl-3-[(E)-2-methylbut-1-enoxy]aniline |
| SMILES | CC/C(C)=C/Oc1c(C)c(-c2ccc(C(C)(F)F)cc2)cc(NC)c1Br |
| InChI | InChI=1S/C21H24BrF2NO/c1-6-13(2)12-26-20-14(3)17(11-18(25-5)19(20)22)15-7-9-16(10-8-15)21(4,23)24/h7-12,25H,6H2,1-5H3/b13-12+ |
| InChIKey | XWNTZOVRGLJQHM-OUKQBFOZSA-N |
| XLogP | 7.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|