C19H19BrF3NO2 — CID 168905253
2-bromo-4-methyl-3-[(E)-2-methylbut-1-enoxy]-5-[4-(trifluoromethoxy)phenyl]aniline (PubChem CID 168905253) has the molecular formula C19H19BrF3NO2 and a molecular weight of 430.26 g/mol. Its IUPAC name is 2-bromo-4-methyl-3-[(E)-2-methylbut-1-enoxy]-5-[4-(trifluoromethoxy)phenyl]aniline.
| Compound Name | 2-bromo-4-methyl-3-[(E)-2-methylbut-1-enoxy]-5-[4-(trifluoromethoxy)phenyl]aniline |
|---|---|
| PubChem CID | 168905253 |
| Molecular Formula | C19H19BrF3NO2 |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 2-bromo-4-methyl-3-[(E)-2-methylbut-1-enoxy]-5-[4-(trifluoromethoxy)phenyl]aniline |
| SMILES | CC/C(C)=C/Oc1c(C)c(-c2ccc(OC(F)(F)F)cc2)cc(N)c1Br |
| InChI | InChI=1S/C19H19BrF3NO2/c1-4-11(2)10-25-18-12(3)15(9-16(24)17(18)20)13-5-7-14(8-6-13)26-19(21,22)23/h5-10H,4,24H2,1-3H3/b11-10+ |
| InChIKey | XDWUTDRJYNETBO-ZHACJKMWSA-N |
| XLogP | 6.60 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|