C21H26BrF3N2O — CID 168905590
2-bromo-4-methyl-5-[4-(trifluoromethoxy)phenyl]aniline;(E)-N,N,2-trimethylbut-1-en-1-amine (PubChem CID 168905590) has the molecular formula C21H26BrF3N2O and a molecular weight of 459.35 g/mol. Its IUPAC name is 2-bromo-4-methyl-5-[4-(trifluoromethoxy)phenyl]aniline;(E)-N,N,2-trimethylbut-1-en-1-amine.
| Compound Name | 2-bromo-4-methyl-5-[4-(trifluoromethoxy)phenyl]aniline;(E)-N,N,2-trimethylbut-1-en-1-amine |
|---|---|
| PubChem CID | 168905590 |
| Molecular Formula | C21H26BrF3N2O |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 2-bromo-4-methyl-5-[4-(trifluoromethoxy)phenyl]aniline;(E)-N,N,2-trimethylbut-1-en-1-amine |
| SMILES | CC/C(C)=C/N(C)C.Cc1cc(Br)c(N)cc1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H11BrF3NO.C7H15N/c1-8-6-12(15)13(19)7-11(8)9-2-4-10(5-3-9)20-14(16,17)18;1-5-7(2)6-8(3)4/h2-7H,19H2,1H3;6H,5H2,1-4H3/b;7-6+ |
| InChIKey | LSNSUABWQPVHKL-UETGHTDLSA-N |
| XLogP | 6.77 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|