C18H15BrF3NO2 — CID 168905574
8-bromo-3-ethyl-5-[4-(trifluoromethoxy)phenyl]-4H-chromen-7-amine (PubChem CID 168905574) has the molecular formula C18H15BrF3NO2 and a molecular weight of 414.22 g/mol. Its IUPAC name is 8-bromo-3-ethyl-5-[4-(trifluoromethoxy)phenyl]-4H-chromen-7-amine.
| Compound Name | 8-bromo-3-ethyl-5-[4-(trifluoromethoxy)phenyl]-4H-chromen-7-amine |
|---|---|
| PubChem CID | 168905574 |
| Molecular Formula | C18H15BrF3NO2 |
| Molecular Weight | 414.22 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 8-bromo-3-ethyl-5-[4-(trifluoromethoxy)phenyl]-4H-chromen-7-amine |
| SMILES | CCC1=COc2c(Br)c(N)cc(-c3ccc(OC(F)(F)F)cc3)c2C1 |
| InChI | InChI=1S/C18H15BrF3NO2/c1-2-10-7-14-13(8-15(23)16(19)17(14)24-9-10)11-3-5-12(6-4-11)25-18(20,21)22/h3-6,8-9H,2,7,23H2,1H3 |
| InChIKey | WKNCGKFYSFRPIR-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.22 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|